5

Is the Earth's magnetic field parallel to the ground at all locations? If not, where is it parallel to the surface? Is its strength the same at all locations? ...

Question

Is the Earth's magnetic field parallel to the ground at all locations? If not, where is it parallel to the surface? Is its strength the same at all locations? If not, where is it greatest?

Is the Earth's magnetic field parallel to the ground at all locations? If not, where is it parallel to the surface? Is its strength the same at all locations? If not, where is it greatest?



Answers

(II) A power line carries a current of 95 A west along the tops of 8.5-m-high poles. ($a$) What is the magnitude and direction of the magnetic field produced by this wire at the ground directly below? How does this compare with the Earth's magnetic field of about $\frac{1}{2}$G? ($b$) Where would the
wire's magnetic field cancel the Earth's field?

Horizontal and vertical components off the magnetic field of the earth. So we have be age. Is it good to use easier mu divided by four by our cube Cool side 11 dime and b for it to go Museum I'm you if either By two pi r cubed sign I've loved them and we want to show what is the magnitude off the earth's magnetic field after lighting Tau Lambda am So the magnitude off the magnetic field is just there Some off the square off these two guys. So we have Well, hey, bay is you're goingto square root off. Be age Krampus Hey, be square And this is just square root off museum room you for by our cume And then they're square root. Of course, Science Square. I love them bliss for signed square Colome Damn! And this four appears because there is a difference off this four and two here and now we can peek one of this science to transform into one. And then it left us with three science square inside. So we have the answer that we weren't is museum you divide by four by our cube squared off world Blustery signed square off loved I, um, for but be want to show that the inclination off the magnetic field is related to the magnetic A ll latitude so we can used that the detergent off. FYI, physical tow the ratio between B V and B H and is racial. All the numbers cancel. And there is only what's left is too urgent of love em. And then this is what we worked to show is that sergeant off my eye is a two time stagnant of love that

So here we're going to use 1/3 right hand roll to find the magnetic, the magnetic force on the wire. And we are placing the current, um, perpendicular to, uh, the magnetic Earth's magnetic field. So if Earth's magnetic field was running north south, we're placing this current east west. Now we can I point your fingers, um, in the direction of magnetic field. So we we can say curl fingers in direction of the magnetic field, and we can then say that we're going to say the thumb your thumb would be in the direction of the current. And so we can say that than the palm of your hand will be the face in the direction we'll face in the direction of the force on the wire. And so if we were to if the fingers, if we could say the fingers of the right hand are directed north and then the thumb is directed east, then we can say that the palm of your hand is facing upward, or in this case, we can say that. Then the magnetic force on the wire is upwards away from the surface of the earth. Of course, this magnetic field is the magnetic forces, usually much, much less than the force of gravity, especially in a wire that isn't too large. Um, And so, uh, the A wire isn't going to levitate. Usually, wires don't levitate. Um, because the gravitational force simply overcomes the magnetic force. Whatever it may be, that is the end of the solution. Thank you for watching.

So this is simply due to Newton's the Third Law, where every action has an equal and opposite reaction. In this case, every force has an equal and opposite force. So we can say that due to Newton's Third Law, uh, the magnitude of the magnetic force imparted on the compass by uh is equal to that of we can say to that of the magnetic force imparted on Earth by the compass. And we can say that then these two forces act in opposite directions. That is the end of the solution. Thank you for watching.

So for the first situation, um, the wires are running parallel to one another, and the currents are opposite to each other. And so we can say that then, for part A that any point between the two wires, Uh, we can say that then the magnetic field from the two wires will be greater. Uh, then the will be greater than the magnetic field outside the wires. And again, this is simply due to the right hand roll. We know that from the first right hand rule, the curtains that started currents in the two wires are opposite direction. Their magnetic fields are are also opposite to each other outside the two wires. So outside of the two wires, the magnetic fields are actually opposite to one another. But between the two wires that magnetic fields act in the same direction, which means that in between two wires, the magnitude of the magnetic field will be greater than outside of the two hires. For Part B, we want to see again. We have to parallel wires, both with currents running in opposite directions. However, we want to have essentially the effective a magnetic field essentially be equal to two times the magnetic field coming from one mind from one wire and that occurs right at the midpoint. And so here, right at the midpoint, the resultant field is twice that from each wire again at a point exactly the same distance from the two wires. And so we can say that then this occurs at the midpoint. So the midpoint between the two wires now reports. See, it's a bit different in the sense that we have two parallel wires. However, both of their currents are running in the same direction, which means that outside the wires, it's the exact opposite. We can say outside of the wires, the magnitude of the magnetic field will be greater than inside of the waters, and we can say that at equal distance from the both from both wires, both parallel wires with currents acting in the same direction. At the mid point, we can say that the magnetic field at the mid point will be raise. A resultant will be equal to zero. Tesla's due to both wires, and this occurs again, midpoint between two wires between the two wires. That is the end of the solution. Thank you for watching


Similar Solved Questions

4 answers
WAR+Rbe Froie that difkctcattablc V()I < kl+1 fobkHlunctiou with f(0) 1 € RMldwith Ir'(r)I < ! [or uI Te R-
WAR+Rbe Froie that difkctcattablc V()I < kl+1 fobkHlunctiou with f(0) 1 € R Mldwith Ir'(r)I < ! [or uI Te R-...
4 answers
Ntnur PreviDus Ansaers LerhnCacil 7.5.025. arof Submissioma Ueat relative extrema and saddle points of the function. (If an answer does not exist, enter DNE Find the critical points; Kx, Y) = 12x2 15y2 48X 75yRelative maximum of fx; Y)at (x,Y)Relative minimum((x,(x,Y)Saddle point of f(x, v)at (x, Y) =Ust the critical polnt for which the Second-Partials Test falls_(y)Submit Answer
ntnur PreviDus Ansaers LerhnCacil 7.5.025. arof Submissioma Ueat relative extrema and saddle points of the function. (If an answer does not exist, enter DNE Find the critical points; Kx, Y) = 12x2 15y2 48X 75y Relative maximum of fx; Y) at (x,Y) Relative minimum ((x, (x,Y) Saddle point of f(x, v) a...
5 answers
Exercise 6. Find the matrix of the operator T P3 4 Pz, where T is given by T (a + bx + cx2 + dx3) = b + 2cx + 3dx2 with respect to the bases B = {1,1,12,23} and C = {1,1,= 2x2 -1}.
Exercise 6. Find the matrix of the operator T P3 4 Pz, where T is given by T (a + bx + cx2 + dx3) = b + 2cx + 3dx2 with respect to the bases B = {1,1,12,23} and C = {1,1,= 2x2 -1}....
5 answers
OH9.118 #The chemical equations for the combustion reactions of methane and propane are: . CHa 2 02 COz 2 HzO + 213 kcal C;Hg 5 0z - 3 COz 4 HzO + 531 kcalBased on these equations; which produces more heat when it burns: 1.00 g of methane o 1.00 g of propane? b) Based on these equations, which produces more Sun` carbon dioxide when it burns: 1.00 g of merbzne or 1.00 g of propane?
OH 9.118 #The chemical equations for the combustion reactions of methane and propane are: . CHa 2 02 COz 2 HzO + 213 kcal C;Hg 5 0z - 3 COz 4 HzO + 531 kcal Based on these equations; which produces more heat when it burns: 1.00 g of methane o 1.00 g of propane? b) Based on these equations, which pr...
5 answers
Multiple choice test has 10 questions and possible answers for each question. Suppose you randomly guess on all 10 questions. Let X be the number of questions that YOu answer correctly. (a) What is an appropriate random variable to model X? Specify all parameters. (6) Calculate E(X) and Var(X):
multiple choice test has 10 questions and possible answers for each question. Suppose you randomly guess on all 10 questions. Let X be the number of questions that YOu answer correctly. (a) What is an appropriate random variable to model X? Specify all parameters. (6) Calculate E(X) and Var(X):...
5 answers
Mnich 0t tna faliownKn[routivanormroVrnerd !Faren
mnich 0t tna faliown Kn[routivanormro Vrnerd !Faren...
5 answers
For the molecule beside is : Cz The correct point group Selec one; True c-c-c-F False
for the molecule beside is : Cz The correct point group Selec one; True c-c-c-F False...
5 answers
Using Table E; find the critical value(s) for the / test for , left-tailed test with n = 8 and a = 0.025. Enter the answers separated by 4 comma if neededCritical value(s) =
Using Table E; find the critical value(s) for the / test for , left-tailed test with n = 8 and a = 0.025. Enter the answers separated by 4 comma if needed Critical value(s) =...
5 answers
An-cote sletoid Kith 66 tums Mentc field?soleno&current Or 04750 4272r05stomdunNced Hdp?
An-cote sletoid Kith 66 tums Mentc field? soleno& current Or 04750 4 272r05 stomdun Nced Hdp?...
5 answers
Substance and StateΔG∘f∘kJ/molC2H4(g)68.1Cl2 (g)0CH2ClCH2Cl(l)-79.6Use the values of ΔG∘fΔGf∘ in the introduction tocalculate the standard free-energy change for the synthesis ofdichloroethane from ethylene and chlorine.C2H4(g)+Cl2(g)→CH2ClCH2Cl(l)C2H4(g)+Cl2(g)→CH2ClCH2Cl(l)Express your answer using one decimal place and include theappropriate units.
Substance and State ΔG∘f∘ kJ/mol C2H4(g) 68.1 Cl2 (g) 0 CH2ClCH2Cl(l) -79.6 Use the values of ΔG∘fΔGf∘ in the introduction to calculate the standard free-energy change for the synthesis of dichloroethane from ethylene and chlorine. C2H4(g)+Cl2(g)→CH2ClCH2Cl(l)C...
5 answers
Lead base primers were introduced years ago to replace toxicmercury (II) fulminate. If a percussion cap contains 0.550 g of Hg(CNO)2, how many atoms of mercury are present?
Lead base primers were introduced years ago to replace toxic mercury (II) fulminate. If a percussion cap contains 0.550 g of Hg (CNO)2, how many atoms of mercury are present?...
5 answers
Often we learn two reagents that do the same reaction. Explainthe practical difference between H2CrO4 and PCC. What are thesereagents used to do, when would you use each?
Often we learn two reagents that do the same reaction. Explain the practical difference between H2CrO4 and PCC. What are these reagents used to do, when would you use each?...
5 answers
WGielna JDCM Anurcopoar E p8 47 ~1022 alnctronscub € cantimatareMipasmmiarWnktoun magnthc helas thatnerpandiculMorthIcwIr? Hali 'oltaone "han92VYLe>4ril
WGielna JDCM Anur copoar E p 8 47 ~1022 alnctrons cub € cantimatare Mipasm miar Wnktoun magnthc helas that nerpandicul Morth IcwIr? Hali 'oltaone "han 92VY Le>4ril...
5 answers
18. Which of the following would have the strongest intermolecular forces? CH;CHzCH} b. CH3CHCHzCH3 CH;CH_CHzCHzOH d. HOCHZCH CHzCHzOH
18. Which of the following would have the strongest intermolecular forces? CH;CHzCH} b. CH3CHCHzCH3 CH;CH_CHzCHzOH d. HOCHZCH CHzCHzOH...
5 answers
[-/5 Points]DETAILS69.2 +69*4.69 X_xtx-1BxtcView Previous Question Questlon af 10 Vlew Next Questionthen
[-/5 Points] DETAILS 69.2 +69*4.69 X_xtx-1 Bxtc View Previous Question Questlon af 10 Vlew Next Question then...
5 answers
Eal, 300 & car Is movin? 01 1.80 m/8 on friclionless Aeditnan# colkjas th 4 larger, 4.00 Kg cart 0' resL Atcr cbin ta umell cert recolls 01 0,880 m/8Pad 4Whal Iho #pood ol tho larpo catt nlor colicion? Eapron Anmern wltn tNo #ppropriaie UniteValueUnitsSubmutBrutiaut Ananett ReanAnentt
Eal, 300 & car Is movin? 01 1.80 m/8 on friclionless Aeditnan# colkjas th 4 larger, 4.00 Kg cart 0' resL Atcr cbin ta umell cert recolls 01 0,880 m/8 Pad 4 Whal Iho #pood ol tho larpo catt nlor colicion? Eapron Anmern wltn tNo #ppropriaie Unite Value Units Submut Brutiaut Ananett ReanAnen...

-- 0.020614--